CAS 2549160-47-4 appears in our catalog under these names: 1-(4,4,4-Trifluoro-3-hydroxybutyl)-1H-pyrazole-5-carboxylic acid, 98%, 1-(4,4,4-Trifluoro-3-hydroxybutyl)-1H-pyrazole-5-carboxylic acid, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
2-(4,4,4-trifluoro-3-hydroxybutyl)pyrazole-3-carboxylic acid (CAS 2549160-47-4) is a chemical compound with the molecular formula C8H9F3N2O3 and a molecular weight of 238.16 g/mol. IUPAC name: 2-(4,4,4-trifluoro-3-hydroxybutyl)pyrazole-3-carboxylic acid. InChIKey: VKBZGIMYRNKIKG-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O3 |
|---|---|
| Molecular weight | 238.16 g/mol |
| IUPAC name | 2-(4,4,4-trifluoro-3-hydroxybutyl)pyrazole-3-carboxylic acid |
| InChIKey | VKBZGIMYRNKIKG-UHFFFAOYSA-N |
| SMILES | C1=C(N(N=C1)CCC(C(F)(F)F)O)C(=O)O |
Computed by PubChem (NCBI)