cas: 2096332-77-1 — see every product listed under this CAS number, including other names
1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)butan-1-one, 97% (CAS 2096332-77-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691846-250MG |
| cas | 2096332-77-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 950.72 Pln | |
| Fluorochem | 5g | 3595.63 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-1-one (CAS 2096332-77-1) is a chemical compound with the molecular formula C16H23BO3 and a molecular weight of 274.2 g/mol. IUPAC name: 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-1-one. InChIKey: KXACZLKHSCCLGY-UHFFFAOYSA-N.
| Molecular formula | C16H23BO3 |
|---|---|
| Molecular weight | 274.2 g/mol |
| IUPAC name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]butan-1-one |
| InChIKey | KXACZLKHSCCLGY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)CCC |
Computed by PubChem (NCBI)