cas: 852227-90-8 — see every product listed under this CAS number, including other names
1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)pyrrolidine 95% (CAS 852227-90-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A195241-100mg |
| cas | 852227-90-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 743.06 Pln | |
| Ambeed | 25g | 2445.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A195241 |
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine (CAS 852227-90-8) is a chemical compound with the molecular formula C16H24BNO2 and a molecular weight of 273.2 g/mol. IUPAC name: 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine. InChIKey: DWJNNJSONWFVBT-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO2 |
|---|---|
| Molecular weight | 273.2 g/mol |
| IUPAC name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine |
| InChIKey | DWJNNJSONWFVBT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3CCCC3 |
Computed by PubChem (NCBI)