CAS 1036990-23-4 appears in our catalog under these names: 4-[(1-Azetidinyl)methyl]phenylboronic acid pinacol ester, 95%, 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)azetidine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]azetidine (CAS 1036990-23-4) is a chemical compound with the molecular formula C16H24BNO2 and a molecular weight of 273.2 g/mol. IUPAC name: 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]azetidine. InChIKey: NECJDNOVQJOGHG-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO2 |
|---|---|
| Molecular weight | 273.2 g/mol |
| IUPAC name | 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]azetidine |
| InChIKey | NECJDNOVQJOGHG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CN3CCC3 |
Computed by PubChem (NCBI)