CAS 2223043-34-1 is the registry number for 2-Cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2223043-34-1) is a chemical compound with the molecular formula C16H24BNO2 and a molecular weight of 273.2 g/mol. IUPAC name: 2-cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: GGDZCIUXHKXMCE-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO2 |
|---|---|
| Molecular weight | 273.2 g/mol |
| IUPAC name | 2-cyclopentyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | GGDZCIUXHKXMCE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C3CCCC3 |
Computed by PubChem (NCBI)