CAS 871366-35-7 is the registry number for (E)-N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzylidene)propan-1-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-propyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine (CAS 871366-35-7) is a chemical compound with the molecular formula C16H24BNO2 and a molecular weight of 273.2 g/mol. IUPAC name: N-propyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine. InChIKey: UGQQYYZQDNRVLZ-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO2 |
|---|---|
| Molecular weight | 273.2 g/mol |
| IUPAC name | N-propyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanimine |
| InChIKey | UGQQYYZQDNRVLZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C=NCCC |
Computed by PubChem (NCBI)