cas: 151157-53-8 — see every product listed under this CAS number, including other names
1-(4-(Trifluoromethoxy)phenyl)cyclobutane-1-carboxylic acid, 97% (CAS 151157-53-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F701323-100MG |
| cas | 151157-53-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 622.72 Pln | |
| Fluorochem | 1g | 1445.34 Pln | |
| Fluorochem | 5g | 6922.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-[4-(trifluoromethoxy)phenyl]cyclobutane-1-carboxylic acid (CAS 151157-53-8) is a chemical compound with the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. IUPAC name: 1-[4-(trifluoromethoxy)phenyl]cyclobutane-1-carboxylic acid. InChIKey: ZVKAMZKCLVRSDG-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O3 |
|---|---|
| Molecular weight | 260.21 g/mol |
| IUPAC name | 1-[4-(trifluoromethoxy)phenyl]cyclobutane-1-carboxylic acid |
| InChIKey | ZVKAMZKCLVRSDG-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=C(C=C2)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)