CAS 1119452-86-6 is the registry number for 1-(3-Ethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3-ethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 1119452-86-6) is a chemical compound with the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. IUPAC name: 1-(3-ethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: TYQGQVQLTWKKQU-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O3 |
|---|---|
| Molecular weight | 260.21 g/mol |
| IUPAC name | 1-(3-ethoxyphenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | TYQGQVQLTWKKQU-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC(=C1)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)