CAS 2107734-25-6 is the registry number for Methyl 6-(trifluoromethyl)chromane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylate (CAS 2107734-25-6) is a chemical compound with the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. IUPAC name: methyl 6-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylate. InChIKey: ADIOGBWBPPPNPM-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O3 |
|---|---|
| Molecular weight | 260.21 g/mol |
| IUPAC name | methyl 6-(trifluoromethyl)-3,4-dihydro-2H-chromene-3-carboxylate |
| InChIKey | ADIOGBWBPPPNPM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(C=CC(=C2)C(F)(F)F)OC1 |
Computed by PubChem (NCBI)