cas: 71680-92-7 — see every product listed under this CAS number, including other names
1-(4-Acetylphenyl)-2-thiourea, 97% (CAS 71680-92-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018156-1G |
| cas | 71680-92-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 471.73 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 5g | 1502.61 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(4-acetylphenyl)thiourea (CAS 71680-92-7) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: (4-acetylphenyl)thiourea. InChIKey: VVIUKYOXYSWCOF-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | (4-acetylphenyl)thiourea |
| InChIKey | VVIUKYOXYSWCOF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)NC(=S)N |
Computed by PubChem (NCBI)