cas: 1267610-26-3 — see every product listed under this CAS number, including other names
1-(4-Aminophenyl)-3-morpholino-5,6-dihydropyridin-2(1H)-one 95% (CAS 1267610-26-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A431106-5g |
| cas | 1267610-26-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 325.88 Pln | |
| Ambeed | 100g | 1076.81 Pln | |
| Ambeed | 500g | 3935.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A431106 |
1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one (CAS 1267610-26-3) is a chemical compound with the molecular formula C15H19N3O2 and a molecular weight of 273.33 g/mol. IUPAC name: 1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one. InChIKey: YUGIGSPFTMLIMA-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O2 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one |
| InChIKey | YUGIGSPFTMLIMA-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C(=C1)N2CCOCC2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)