cas: 1267610-26-3 — see every product listed under this CAS number, including other names
1-(4-Aminophenyl)-3-morpholino-5,6-dihydropyridin-2(1H)-one, 95%, 95% (CAS 1267610-26-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111T7R-1g |
| cas | 1267610-26-3 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 189.20 Pln | |
| Chemat | 100g | 510.80 Pln | |
| Chemat | 50g | 304.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one (CAS 1267610-26-3) is a chemical compound with the molecular formula C15H19N3O2 and a molecular weight of 273.33 g/mol. IUPAC name: 1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one. InChIKey: YUGIGSPFTMLIMA-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O2 |
|---|---|
| Molecular weight | 273.33 g/mol |
| IUPAC name | 1-(4-aminophenyl)-5-morpholin-4-yl-2,3-dihydropyridin-6-one |
| InChIKey | YUGIGSPFTMLIMA-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C(=C1)N2CCOCC2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)