1-(4-Aminophenyl)-3-morpholinopyridin-2(1H)-one, 95%
cas: 2816305-40-3 — see every product listed under this CAS number, including other names
1-(4-Aminophenyl)-3-morpholinopyridin-2(1H)-one, 95% (CAS 2816305-40-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1971595-100mg |
| cas | 2816305-40-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 809.81 Pln | |
| Ambeed | 250mg | 1538.50 Pln | |
| Ambeed | 1g | 3941.50 Pln | |
| Ambeed | 5g | 10572.00 Pln | |
| BLDpharm | 100mg | 869.72 Pln | |
| BLDpharm | 250mg | 1652.78 Pln | |
| BLDpharm | 1g | 4246.31 Pln | |
| BLDpharm | 5g | 11393.79 Pln | |
| Chemat | 100mg | 784.40 Pln | |
| Chemat | 250mg | 1360.40 Pln | |
| Chemat | 1g | 3568.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-(4-aminophenyl)-3-morpholin-4-ylpyridin-2-one (CAS 2816305-40-3) is a chemical compound with the molecular formula C15H17N3O2 and a molecular weight of 271.31 g/mol. IUPAC name: 1-(4-aminophenyl)-3-morpholin-4-ylpyridin-2-one. InChIKey: SXVSKKDDHWVSEA-UHFFFAOYSA-N.
| Molecular formula | C15H17N3O2 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 1-(4-aminophenyl)-3-morpholin-4-ylpyridin-2-one |
| InChIKey | SXVSKKDDHWVSEA-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=CN(C2=O)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)