cas: 1020253-81-9 — see every product listed under this CAS number, including other names
1-(4-Bromo-2-hydroxy-5-methylphenyl)ethanone, 97%, 97% (CAS 1020253-81-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 25g, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KZ6H-100mg |
| cas | 1020253-81-9 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 500mg | 141.20 Pln | |
| Chemat | 25g | 2334.80 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 558.80 Pln | |
| Chemat | 10g | 971.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromo-2-hydroxy-5-methylphenyl)ethanone (CAS 1020253-81-9) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 1-(4-bromo-2-hydroxy-5-methylphenyl)ethanone. InChIKey: BPQABGQSVOUODJ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 1-(4-bromo-2-hydroxy-5-methylphenyl)ethanone |
| InChIKey | BPQABGQSVOUODJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)O)C(=O)C |
Computed by PubChem (NCBI)