CAS 1224604-15-2 is the registry number for 3-Bromo-2-methoxy-5-methylbenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
3-bromo-2-methoxy-5-methylbenzaldehyde (CAS 1224604-15-2) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 3-bromo-2-methoxy-5-methylbenzaldehyde. InChIKey: CDYURHDIJQGOMM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 3-bromo-2-methoxy-5-methylbenzaldehyde |
| InChIKey | CDYURHDIJQGOMM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)OC)C=O |
Computed by PubChem (NCBI)