CAS 53086-53-6 appears in our catalog under these names: 2-(4-Bromophenyl)propanoic acid, 98%, 2-(4-bromophenyl)propanoic acid, 2-(4-bromophenyl)propanoic acid, 95%, 95%, 2-(4-bromophenyl)propanoic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 10g, 5g, 250mg, 0,25g, 0,5g, 100mg, 500mg.
2-(4-bromophenyl)propanoic acid (CAS 53086-53-6) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 2-(4-bromophenyl)propanoic acid. InChIKey: PFDBEACWLCHWRZ-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 2-(4-bromophenyl)propanoic acid |
| InChIKey | PFDBEACWLCHWRZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)