CAS 35016-63-8 appears in our catalog under these names: (S)-2-Bromo-3-phenylpropionic acid, 95%, (L)-2-Bromo-3-phenylpropionic Acid, (S)–2–Bromo–3–phenylpropionic acid. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 2,5g, 25g, 100mg, 10g.
(2S)-2-bromo-3-phenylpropanoic acid (CAS 35016-63-8) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: (2S)-2-bromo-3-phenylpropanoic acid. InChIKey: WDRSCFNERFONKU-QMMMGPOBSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | (2S)-2-bromo-3-phenylpropanoic acid |
| InChIKey | WDRSCFNERFONKU-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)Br |
Computed by PubChem (NCBI)