cas: 1201643-59-5 — see every product listed under this CAS number, including other names
1-(4-Bromo-2-pyridyl)piperazine, 97%, 97% (CAS 1201643-59-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111QFS-100mg |
| cas | 1201643-59-5 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 443.60 Pln | |
| Chemat | 5g | 1202.00 Pln | |
| Chemat | 25g | 3875.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromo-2-pyridinyl)piperazine (CAS 1201643-59-5) is a chemical compound with the molecular formula C9H12BrN3 and a molecular weight of 242.12 g/mol. IUPAC name: 1-(4-bromo-2-pyridinyl)piperazine. InChIKey: CRQIQJZMQXBIHG-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3 |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 1-(4-bromo-2-pyridinyl)piperazine |
| InChIKey | CRQIQJZMQXBIHG-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CC(=C2)Br |
Computed by PubChem (NCBI)