cas: 1201643-59-5 — see every product listed under this CAS number, including other names
1-(4-Bromopyridin-2-yl)piperazine, 97% (CAS 1201643-59-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211773-100MG |
| cas | 1201643-59-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 1518.23 Pln | |
| Fluorochem | 10g | 2502.26 Pln | |
| Fluorochem | 25g | 4944.11 Pln | |
| Fluorochem | 100g | 13352.61 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-bromo-2-pyridinyl)piperazine (CAS 1201643-59-5) is a chemical compound with the molecular formula C9H12BrN3 and a molecular weight of 242.12 g/mol. IUPAC name: 1-(4-bromo-2-pyridinyl)piperazine. InChIKey: CRQIQJZMQXBIHG-UHFFFAOYSA-N.
| Molecular formula | C9H12BrN3 |
|---|---|
| Molecular weight | 242.12 g/mol |
| IUPAC name | 1-(4-bromo-2-pyridinyl)piperazine |
| InChIKey | CRQIQJZMQXBIHG-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CC(=C2)Br |
Computed by PubChem (NCBI)