1-(4-Bromo-3-chlorophenyl)ethanone, 97%
cas: 3114-31-6 — see every product listed under this CAS number, including other names
1-(4-Bromo-3-chlorophenyl)ethanone, 97% (CAS 3114-31-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A113506-250mg |
| cas | 3114-31-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 437.12 Pln | |
| Ambeed | 25g | 960.00 Pln | |
| Ambeed | 100g | 2612.06 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 142.20 Pln | |
| BLDpharm | 5g | 297.70 Pln | |
| BLDpharm | 10g | 464.31 Pln | |
| BLDpharm | 25g | 1030.77 Pln | |
| BLDpharm | 100g | 2807.92 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-(4-bromo-3-chlorophenyl)ethanone (CAS 3114-31-6) is a chemical compound with the molecular formula C8H6BrClO and a molecular weight of 233.49 g/mol. IUPAC name: 1-(4-bromo-3-chlorophenyl)ethanone. InChIKey: GODIGXNJTHCLHB-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO |
|---|---|
| Molecular weight | 233.49 g/mol |
| IUPAC name | 1-(4-bromo-3-chlorophenyl)ethanone |
| InChIKey | GODIGXNJTHCLHB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)Br)Cl |
Computed by PubChem (NCBI)