Products 53456-09-0

CAS 53456-09-0 appears in our catalog under these names: 2-Bromo-4-methylbenzoyl chloride, 96%, 2-Bromo-4-methylbenzoyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-bromo-4-methylbenzoyl chloride (CAS 53456-09-0) is a chemical compound with the molecular formula C8H6BrClO and a molecular weight of 233.49 g/mol. IUPAC name: 2-bromo-4-methylbenzoyl chloride. InChIKey: QYGFJEIQODJAQF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrClO
Molecular weight233.49 g/mol
IUPAC name2-bromo-4-methylbenzoyl chloride
InChIKeyQYGFJEIQODJAQF-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C(=O)Cl)Br

Computed by PubChem (NCBI)