CAS 1114808-98-8 appears in our catalog under these names: 6-Bromo-2-chloro-3-methylbenzaldehyde, 95%, 6-Bromo-2-chloro-3-methylbenzaldehyde, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 10g, 1g, 5g.
6-bromo-2-chloro-3-methylbenzaldehyde (CAS 1114808-98-8) is a chemical compound with the molecular formula C8H6BrClO and a molecular weight of 233.49 g/mol. IUPAC name: 6-bromo-2-chloro-3-methylbenzaldehyde. InChIKey: CIOQTKGPYAYYDR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO |
|---|---|
| Molecular weight | 233.49 g/mol |
| IUPAC name | 6-bromo-2-chloro-3-methylbenzaldehyde |
| InChIKey | CIOQTKGPYAYYDR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Br)C=O)Cl |
Computed by PubChem (NCBI)