CAS 98288-51-8 is the registry number for 3-Bromophenylacetyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(3-bromophenyl)acetyl chloride (CAS 98288-51-8) is a chemical compound with the molecular formula C8H6BrClO and a molecular weight of 233.49 g/mol. IUPAC name: 2-(3-bromophenyl)acetyl chloride. InChIKey: DFKQZCVLSJIRES-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO |
|---|---|
| Molecular weight | 233.49 g/mol |
| IUPAC name | 2-(3-bromophenyl)acetyl chloride |
| InChIKey | DFKQZCVLSJIRES-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CC(=O)Cl |
Computed by PubChem (NCBI)