cas: 62546-27-4 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-3,5-dimethyl-1H-pyrazole, 97% (CAS 62546-27-4) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC68210CB |
| cas | 62546-27-4 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 108.94 Pln | |
| Thermo Scientific | 1g | 311.05 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
1-(4-bromophenyl)-3,5-dimethylpyrazole (CAS 62546-27-4) is a chemical compound with the molecular formula C11H11BrN2 and a molecular weight of 251.12 g/mol. IUPAC name: 1-(4-bromophenyl)-3,5-dimethylpyrazole. InChIKey: ATCMNDCOEJOOSF-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2 |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3,5-dimethylpyrazole |
| InChIKey | ATCMNDCOEJOOSF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)