cas: 62546-27-4 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-3,5-dimethyl-1H-pyrazole (CAS 62546-27-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g, 25g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | MCA54627-10g |
| cas | 62546-27-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 10g | price on request | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 706.02 Pln | |
| Fluorochem | 25g | 3225.97 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
1-(4-bromophenyl)-3,5-dimethylpyrazole (CAS 62546-27-4) is a chemical compound with the molecular formula C11H11BrN2 and a molecular weight of 251.12 g/mol. IUPAC name: 1-(4-bromophenyl)-3,5-dimethylpyrazole. InChIKey: ATCMNDCOEJOOSF-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2 |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3,5-dimethylpyrazole |
| InChIKey | ATCMNDCOEJOOSF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)