cas: 187998-44-3 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid, >97%, >97% (CAS 187998-44-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113GMP-100mg |
| cas | 187998-44-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 534.80 Pln | |
| Chemat | 250mg | 669.20 Pln | |
| Chemat | 1g | 1370.00 Pln | |
| Chemat | 5g | 3299.60 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromophenyl)-5-methylpyrazole-4-carboxylic acid (CAS 187998-44-3) is a chemical compound with the molecular formula C11H9BrN2O2 and a molecular weight of 281.10 g/mol. IUPAC name: 1-(4-bromophenyl)-5-methylpyrazole-4-carboxylic acid. InChIKey: XHUOEOFQYJPQOZ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O2 |
|---|---|
| Molecular weight | 281.10 g/mol |
| IUPAC name | 1-(4-bromophenyl)-5-methylpyrazole-4-carboxylic acid |
| InChIKey | XHUOEOFQYJPQOZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)