CAS 187998-44-3 appears in our catalog under these names: 1-(4-Bromophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid, 98%, 1-(4-Bromophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid, 95+%, 1-(4-Bromophenyl)-5-methyl-1H-pyrazole-4-carboxylic acid, >97%, >97%, 1-(4-Bromo-phenyl)-5-methyl-1H-pyrazole-4-carboxylic acid, = 98.5% (HPLC). Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
1-(4-bromophenyl)-5-methylpyrazole-4-carboxylic acid (CAS 187998-44-3) is a chemical compound with the molecular formula C11H9BrN2O2 and a molecular weight of 281.10 g/mol. IUPAC name: 1-(4-bromophenyl)-5-methylpyrazole-4-carboxylic acid. InChIKey: XHUOEOFQYJPQOZ-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O2 |
|---|---|
| Molecular weight | 281.10 g/mol |
| IUPAC name | 1-(4-bromophenyl)-5-methylpyrazole-4-carboxylic acid |
| InChIKey | XHUOEOFQYJPQOZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)