Products 1448684-51-2

CAS 1448684-51-2 is the registry number for 2-(2-Bromophenyl)-5-methylpyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(2-bromophenyl)-5-methylpyrazole-3-carboxylic acid (CAS 1448684-51-2) is a chemical compound with the molecular formula C11H9BrN2O2 and a molecular weight of 281.10 g/mol. IUPAC name: 2-(2-bromophenyl)-5-methylpyrazole-3-carboxylic acid. InChIKey: WGWDEAVUWBVQKN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9BrN2O2
Molecular weight281.10 g/mol
IUPAC name2-(2-bromophenyl)-5-methylpyrazole-3-carboxylic acid
InChIKeyWGWDEAVUWBVQKN-UHFFFAOYSA-N
SMILESCC1=NN(C(=C1)C(=O)O)C2=CC=CC=C2Br

Computed by PubChem (NCBI)