Products 1154882-54-8
CAS 1154882-54-8 appears in our catalog under these names: 1-(3-Bromobenzyl)-1h-pyrazole-4-carboxylic acid, 95%, 1-(3-Bromobenzyl)-1H-pyrazole-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-[(3-bromophenyl)methyl]pyrazole-4-carboxylic acid (CAS 1154882-54-8) is a chemical compound with the molecular formula C11H9BrN2O2 and a molecular weight of 281.10 g/mol. IUPAC name: 1-[(3-bromophenyl)methyl]pyrazole-4-carboxylic acid. InChIKey: PHIKZQZADWDNII-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O2 |
|---|---|
| Molecular weight | 281.10 g/mol |
| IUPAC name | 1-[(3-bromophenyl)methyl]pyrazole-4-carboxylic acid |
| InChIKey | PHIKZQZADWDNII-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)CN2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)