cas: 1415719-07-1 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)-3-(prop-2-yn-1-ylamino)pyrrolidine-2,5-dione 97% (CAS 1415719-07-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A719479-100mg |
| cas | 1415719-07-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1193.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A719479 |
1-(4-chlorophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione (CAS 1415719-07-1) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione. InChIKey: GUJVGSHSJPOSCN-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione |
| InChIKey | GUJVGSHSJPOSCN-UHFFFAOYSA-N |
| SMILES | C#CCNC1CC(=O)N(C1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)