cas: 1415719-07-1 — see every product listed under this CAS number, including other names
1-(4-Chlorophenyl)-3-(prop-2-yn-1-ylamino)pyrrolidine-2,5-dione, 97%, 97% (CAS 1415719-07-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HW2B-100mg |
| cas | 1415719-07-1 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 1g | 1749.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-(4-chlorophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione (CAS 1415719-07-1) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: 1-(4-chlorophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione. InChIKey: GUJVGSHSJPOSCN-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3-(prop-2-ynylamino)pyrrolidine-2,5-dione |
| InChIKey | GUJVGSHSJPOSCN-UHFFFAOYSA-N |
| SMILES | C#CCNC1CC(=O)N(C1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)