cas: 1394962-80-1 — see every product listed under this CAS number, including other names
1-(4-Fluoro-3-isopropoxyphenyl)ethan-1-one, 98% (CAS 1394962-80-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1656808-25g |
| cas | 1394962-80-1 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 41200.18 Pln | |
| AmBeed | 5g | 12341.35 Pln | |
| AmBeed | 10g | 20973.61 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(4-fluoro-3-propan-2-yloxyphenyl)ethanone (CAS 1394962-80-1) is a chemical compound with the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. IUPAC name: 1-(4-fluoro-3-propan-2-yloxyphenyl)ethanone. InChIKey: VDEHYEJKPMWQCC-UHFFFAOYSA-N.
| Molecular formula | C11H13FO2 |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 1-(4-fluoro-3-propan-2-yloxyphenyl)ethanone |
| InChIKey | VDEHYEJKPMWQCC-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1)C(=O)C)F |
Computed by PubChem (NCBI)