Products 476429-16-0
CAS 476429-16-0 appears in our catalog under these names: 3-Fluoro-alpha,alpha-dimethyl-benzeneacetic acid, methyl ester, 95%, 3-Fluoro-alpha,alpha-dimethyl-benzeneacetic acid, methyl ester, 98%, 98%, Methyl 2-(3-fluorophenyl)-2-methylpropanoate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Methyl 2-(3-fluorophenyl)-2-methylpropanoate (CAS 476429-16-0) is a chemical compound with the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. IUPAC name: methyl 2-(3-fluorophenyl)-2-methylpropanoate. InChIKey: JQSDDXXKNUEUGT-UHFFFAOYSA-N.
| Molecular formula | C11H13FO2 |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | methyl 2-(3-fluorophenyl)-2-methylpropanoate |
| InChIKey | JQSDDXXKNUEUGT-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC=C1)F)C(=O)OC |
Computed by PubChem (NCBI)