CAS 1256481-38-5 is the registry number for Ethyl 4-fluoro-3,5-dimethylbenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
Ethyl 4-fluoro-3,5-dimethylbenzoate (CAS 1256481-38-5) is a chemical compound with the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. IUPAC name: ethyl 4-fluoro-3,5-dimethylbenzoate. InChIKey: AMQMJNUHGJTCOW-UHFFFAOYSA-N.
| Molecular formula | C11H13FO2 |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | ethyl 4-fluoro-3,5-dimethylbenzoate |
| InChIKey | AMQMJNUHGJTCOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)C)F)C |
Computed by PubChem (NCBI)