Products 1017779-63-3

CAS 1017779-63-3 is the registry number for 3-(4-Fluoro-3,5-dimethylphenyl)propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(4-fluoro-3,5-dimethylphenyl)propanoic acid (CAS 1017779-63-3) is a chemical compound with the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. IUPAC name: 3-(4-fluoro-3,5-dimethylphenyl)propanoic acid. InChIKey: QTKWKNDSBHCYCF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13FO2
Molecular weight196.22 g/mol
IUPAC name3-(4-fluoro-3,5-dimethylphenyl)propanoic acid
InChIKeyQTKWKNDSBHCYCF-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1F)C)CCC(=O)O

Computed by PubChem (NCBI)