cas: 869970-25-2 — see every product listed under this CAS number, including other names
1-(4-Hydroxyphenyl)cyclopropanecarboxylic acid, 97% (CAS 869970-25-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F601478-100MG |
| cas | 869970-25-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 1200.64 Pln | |
| Fluorochem | 10g | 1965.99 Pln | |
| Fluorochem | 25g | 3855.95 Pln | |
| Fluorochem | 100g | 10442.17 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(4-hydroxyphenyl)cyclopropane-1-carboxylic acid (CAS 869970-25-2) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 1-(4-hydroxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: NYMJUDIMUFFNEJ-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | NYMJUDIMUFFNEJ-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)