CAS 869970-25-2 appears in our catalog under these names: 1-(4-Hydroxy-phenyl)-cyclopropanecarboxylic acid, 95%, 1-(4-Hydroxyphenyl)cyclopropanecarboxylic acid, 98%, 1-(4-Hydroxy-phenyl)-cyclopropanecarboxylic acid, 1-(4-Hydroxyphenyl)cyclopropanecarboxylic acid, 97%, 97%, 1-(4-Hydroxyphenyl)cyclopropanecarboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 2,5g, 100mg, 25g, 100g.
1-(4-hydroxyphenyl)cyclopropane-1-carboxylic acid (CAS 869970-25-2) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 1-(4-hydroxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: NYMJUDIMUFFNEJ-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | NYMJUDIMUFFNEJ-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)