cas: 38560-30-4 — see every product listed under this CAS number, including other names
1-(4-Nitrophenyl)piperidin-2-one 97% (CAS 38560-30-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A189532-250mg |
| cas | 38560-30-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 10g | 565.06 Pln | |
| Ambeed | 25g | 1115.75 Pln | |
| Ambeed | 100g | 3841.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A189532 |
1-(4-nitrophenyl)piperidin-2-one (CAS 38560-30-4) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 1-(4-nitrophenyl)piperidin-2-one. InChIKey: VPCQXIGQMFWXII-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 1-(4-nitrophenyl)piperidin-2-one |
| InChIKey | VPCQXIGQMFWXII-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)