cas: 774-55-0 — see every product listed under this CAS number, including other names
1-(5,6,7,8-Tetrahydronaphthalen-2-yl)ethanone, 96% (CAS 774-55-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209650-1G |
| cas | 774-55-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 25g | 924.69 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone (CAS 774-55-0) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone. InChIKey: VEPUKHYQNXSSKV-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone |
| InChIKey | VEPUKHYQNXSSKV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(CCCC2)C=C1 |
Computed by PubChem (NCBI)