Products 755002-43-8
CAS 755002-43-8 appears in our catalog under these names: 1-Cyclobutyl-2-phenylethan-1-one, 95%, 1–Cyclobutyl–2–phenylethanone, 1-Cyclobutyl-2-phenylethanone 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 50mg.
1-cyclobutyl-2-phenylethanone (CAS 755002-43-8) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 1-cyclobutyl-2-phenylethanone. InChIKey: IRIMLJXRWZREDY-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 1-cyclobutyl-2-phenylethanone |
| InChIKey | IRIMLJXRWZREDY-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)