cas: 1193779-97-3 — see every product listed under this CAS number, including other names
1-(5-Chloro-2-methylphenyl)propan-1-one, 95+%, 95+% (CAS 1193779-97-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111INW-100mg |
| cas | 1193779-97-3 |
| size | 100mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 947.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
1-(5-chloro-2-methylphenyl)propan-1-one (CAS 1193779-97-3) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: 1-(5-chloro-2-methylphenyl)propan-1-one. InChIKey: VWJBDJMIASDRMJ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | 1-(5-chloro-2-methylphenyl)propan-1-one |
| InChIKey | VWJBDJMIASDRMJ-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=CC(=C1)Cl)C |
Computed by PubChem (NCBI)