CAS 938-18-1 appears in our catalog under these names: 2,4,6-Trimethylbenzoyl chloride, 97%, 2,4,6–Trimethylbenzoyl chloride, 2,4,6-Trimethylbenzoyl chloride, 98+% , 2,4,6-Trimethylbenzoyl Chloride, >98.0%(GC)(T), 2,4,6-Trimethylbenzoyl chloride, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 100g, 1kg, 25g, 500g, 5g, 250g, 10g, 50g.
2,4,6-trimethylbenzoyl chloride (CAS 938-18-1) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: 2,4,6-trimethylbenzoyl chloride. InChIKey: UKRQMDIFLKHCRO-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | 2,4,6-trimethylbenzoyl chloride |
| InChIKey | UKRQMDIFLKHCRO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)Cl)C |
Computed by PubChem (NCBI)