CAS 2623-45-2 is the registry number for 2-Chloro-1-(2,4-dimethylphenyl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-1-(2,4-dimethylphenyl)ethanone (CAS 2623-45-2) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: 2-chloro-1-(2,4-dimethylphenyl)ethanone. InChIKey: SJMUGKXTDUSEOC-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | 2-chloro-1-(2,4-dimethylphenyl)ethanone |
| InChIKey | SJMUGKXTDUSEOC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)CCl)C |
Computed by PubChem (NCBI)