CAS 55312-97-5 appears in our catalog under these names: 2,5-Dimethylphenylacetyl chloride, 95%, 2,5–Dimethylphenylacetyl Chloride, 2,5-Dimethylphenylacetyl chloride 99% GC, 2,5-Dimethylbenzeneacetyl chloride, 99% GC, 99% GC, (2,5-Dimethylphenyl)acetyl chloride, 99% GC. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 100g.
2-(2,5-dimethylphenyl)acetyl chloride (CAS 55312-97-5) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)acetyl chloride. InChIKey: PZRANTBLOIKHJY-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)acetyl chloride |
| InChIKey | PZRANTBLOIKHJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CC(=O)Cl |
Computed by PubChem (NCBI)