cas: 453562-71-5 — see every product listed under this CAS number, including other names
1-(6-Amino-3,3-dimethylindolin-1-yl)ethanone, 97% (CAS 453562-71-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216422-100MG |
| cas | 453562-71-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 263.47 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 695.61 Pln | |
| Fluorochem | 5g | 1762.94 Pln | |
| Fluorochem | 10g | 3475.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-(6-amino-3,3-dimethyl-2H-indol-1-yl)ethanone (CAS 453562-71-5) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: 1-(6-amino-3,3-dimethyl-2H-indol-1-yl)ethanone. InChIKey: FDFKETITWKJRNI-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | 1-(6-amino-3,3-dimethyl-2H-indol-1-yl)ethanone |
| InChIKey | FDFKETITWKJRNI-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC(C2=C1C=C(C=C2)N)(C)C |
Computed by PubChem (NCBI)