cas: 453562-71-5 — see every product listed under this CAS number, including other names
1-Acetyl-6-amino-3,3-dimethylindoline, 98.18% (CAS 453562-71-5) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 250 mg, 5 g, 500 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-42662-100 mg |
| cas | 453562-71-5 |
| size | 100 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 328.98 Pln | |
| MedChemExpress | 250 mg | 477.59 Pln | |
| MedChemExpress | 5 g | 2349.12 Pln | |
| MedChemExpress | 500 mg | 695.86 Pln | |
| MedChemExpress | 1 g | 1011.65 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.18% |
1-(6-amino-3,3-dimethyl-2H-indol-1-yl)ethanone (CAS 453562-71-5) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: 1-(6-amino-3,3-dimethyl-2H-indol-1-yl)ethanone. InChIKey: FDFKETITWKJRNI-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | 1-(6-amino-3,3-dimethyl-2H-indol-1-yl)ethanone |
| InChIKey | FDFKETITWKJRNI-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC(C2=C1C=C(C=C2)N)(C)C |
Computed by PubChem (NCBI)