cas: 453562-71-5 — see every product listed under this CAS number, including other names
1-(6-Amino-3,3-dimethylindolin-1-yl)ethanone, 98%, 98% (CAS 453562-71-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D06C-100mg |
| cas | 453562-71-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 539.60 Pln | |
| Chemat | 5g | 1288.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(6-amino-3,3-dimethyl-2H-indol-1-yl)ethanone (CAS 453562-71-5) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: 1-(6-amino-3,3-dimethyl-2H-indol-1-yl)ethanone. InChIKey: FDFKETITWKJRNI-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | 1-(6-amino-3,3-dimethyl-2H-indol-1-yl)ethanone |
| InChIKey | FDFKETITWKJRNI-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC(C2=C1C=C(C=C2)N)(C)C |
Computed by PubChem (NCBI)