1-(6-Bromo-4-chloropyridin-2-yl)ethanone, 97%
cas: 1060815-77-1 — see every product listed under this CAS number, including other names
1-(6-Bromo-4-chloropyridin-2-yl)ethanone, 97% (CAS 1060815-77-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A577063-100mg |
| cas | 1060815-77-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 576.19 Pln | |
| Ambeed | 250mg | 926.62 Pln | |
| Ambeed | 1g | 2384.00 Pln | |
| Ambeed | 5g | 8163.44 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 908.59 Pln | |
| BLDpharm | 1g | 2335.87 Pln | |
| BLDpharm | 5g | 8000.54 Pln | |
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 712.40 Pln | |
| Chemat | 1g | 1816.40 Pln | |
| Chemat | 5g | 8205.20 Pln | |
| Fluorochem | 250mg | 883.04 Pln | |
| Fluorochem | 1g | 2241.94 Pln | |
| Fluorochem | 5g | 7464.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-(6-bromo-4-chloro-2-pyridinyl)ethanone (CAS 1060815-77-1) is a chemical compound with the molecular formula C7H5BrClNO and a molecular weight of 234.48 g/mol. IUPAC name: 1-(6-bromo-4-chloro-2-pyridinyl)ethanone. InChIKey: FGIURHMTGBKIBQ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO |
|---|---|
| Molecular weight | 234.48 g/mol |
| IUPAC name | 1-(6-bromo-4-chloro-2-pyridinyl)ethanone |
| InChIKey | FGIURHMTGBKIBQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NC(=CC(=C1)Cl)Br |
Computed by PubChem (NCBI)