CAS 1310416-51-3 appears in our catalog under these names: 3-Bromo-2-methylpyridine-6-carbonyl chloride, 95%, 3-BROMO-2-METHYLPYRIDINE-6-CARBONYL CHLORIDE, ≥95%, 5-Bromo-6-methylpicolinoyl chloride, 97%, 3-Bromo-2-methylpyridine-6-carbonyl chloride, ≥95%, ≥95%. Offered by: Combi-blocks, Fluorochem, AmBeed, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
5-bromo-6-methylpyridine-2-carbonyl chloride (CAS 1310416-51-3) is a chemical compound with the molecular formula C7H5BrClNO and a molecular weight of 234.48 g/mol. IUPAC name: 5-bromo-6-methylpyridine-2-carbonyl chloride. InChIKey: MEJCGQNNKQPWHR-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO |
|---|---|
| Molecular weight | 234.48 g/mol |
| IUPAC name | 5-bromo-6-methylpyridine-2-carbonyl chloride |
| InChIKey | MEJCGQNNKQPWHR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C(=O)Cl)Br |
Computed by PubChem (NCBI)