CAS 29203-58-5 appears in our catalog under these names: 4-Bromo-alpha-chlorobenzaldoxime, 95%, 4–BROMO–N–HYDROXYBENZIMIDOYL CHLORIDE, 4-Bromo-N-hydroxybenzenecarboximidoyl chloride, 97%, 97%, Benzenecarboximidoyl chloride, 4-bromo-N-hydroxy-, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
(1Z)-4-bromo-N-hydroxybenzenecarboximidoyl chloride (CAS 29203-58-5) is a chemical compound with the molecular formula C7H5BrClNO and a molecular weight of 234.48 g/mol. IUPAC name: (1Z)-4-bromo-N-hydroxybenzenecarboximidoyl chloride. InChIKey: ZOPFQZFNZNMZEF-YFHOEESVSA-N.
| Molecular formula | C7H5BrClNO |
|---|---|
| Molecular weight | 234.48 g/mol |
| IUPAC name | (1Z)-4-bromo-N-hydroxybenzenecarboximidoyl chloride |
| InChIKey | ZOPFQZFNZNMZEF-YFHOEESVSA-N |
| SMILES | C1=CC(=CC=C1/C(=N/O)/Cl)Br |
Computed by PubChem (NCBI)